Ethyl 3-(2,5-dichlorophenyl)-3-oxopropanoate structure
|
Common Name | Ethyl 3-(2,5-dichlorophenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 53090-44-1 | Molecular Weight | 261.10100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-(2,5-dichlorophenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10Cl2O3 |
|---|---|
| Molecular Weight | 261.10100 |
| Exact Mass | 260.00100 |
| PSA | 43.37000 |
| LogP | 3.12930 |
| InChIKey | LLERZSQBJSIOLA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cc(Cl)ccc1Cl |
| HS Code | 2918300090 |
|---|
|
~%
Ethyl 3-(2,5-di... CAS#:53090-44-1 |
| Literature: Takeda Chemical Industries, Ltd. Patent: EP1340749 A1, 2003 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,5-Dichlor-benzoyl-essigsaeureaethylester |
| 2,5-Dichlor-benzoylessigsaeure-ethylester |