bis(4-fluorophenyl)methanethione structure
|
Common Name | bis(4-fluorophenyl)methanethione | ||
|---|---|---|---|---|
| CAS Number | 53117-13-8 | Molecular Weight | 234.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8F2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(4-fluorophenyl)methanethione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8F2S |
|---|---|
| Molecular Weight | 234.26400 |
| Exact Mass | 234.03100 |
| PSA | 32.09000 |
| LogP | 3.73110 |
| InChIKey | NHJFTFOLSYVFRZ-UHFFFAOYSA-N |
| SMILES | Fc1ccc(C(=S)c2ccc(F)cc2)cc1 |
|
~%
bis(4-fluorophe... CAS#:53117-13-8 |
| Literature: Wilker, Stefanie; Erker, Gerhard Journal of the American Chemical Society, 1995 , vol. 117, # 44 p. 10922 - 10930 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 4,4'-difluorothiobenzophenone |
| Methanethione,bis(4-fluorophenyl) |
| 4,4'-Difluorthiobenzophenon |