4,4′-difluorobenzophenone structure
|
Common Name | 4,4′-difluorobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 345-92-6 | Molecular Weight | 218.199 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 308.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H8F2O | Melting Point | 102-105 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 118.4±17.9 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | bis(4-fluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.8±27.0 °C at 760 mmHg |
| Melting Point | 102-105 °C(lit.) |
| Molecular Formula | C13H8F2O |
| Molecular Weight | 218.199 |
| Flash Point | 118.4±17.9 °C |
| Exact Mass | 218.054321 |
| PSA | 17.07000 |
| LogP | 3.62 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | LSQARZALBDFYQZ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)c1ccc(F)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H411 |
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | DJ0685000 |
| Packaging Group | I; II; III |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Oxidative metabolism of flunarizine in rat liver microsomes.
Res. Commun. Chem. Pathol. Pharmacol. 78(1) , 85-95, (1992) The oxidative metabolism of flunarizine [1-[bis(4-fluorophenyl)-methyl]-4-(3-phenyl-2-propenyl)piperazine, FZ] to 1-[bis-(4-fluorophenyl)methyl]piperazine (M-1), 1-[bis(4-fluorophenyl)methyl]-4-[3-(4'... |
|
|
Poly (aryl ether ketone) s with carboxylic acid groups: synthesis, sulfonation and crosslinking. Liu B, et al.
J. Mater. Chem. 18(39) , 4675-4682, (2008)
|
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| p,p'-Difluorobenzophenone |
| Di-p-fluorophenyl ketone |
| 4,4‘-Difluorobenzophenone |
| Bis(4-fluorophenyl)methanone |
| EINECS 206-466-3 |
| 4-fluorophenyl ketone |
| Bis(4-Fluorophenyl)-Methanone |
| 4.4'-difluorobenzophenone |
| 4,4'-Difluorobenzophenone |
| p-Fluorophenyl ketone |
| 4,4′-difluorobenzophenone |
| di(4-fluorophenyl)methanone |
| MFCD00000353 |