2,4-bis(trifluoromethyl)benzoyl chloride structure
|
Common Name | 2,4-bis(trifluoromethyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 53130-43-1 | Molecular Weight | 276.56300 | |
| Density | 1.512g/cm3 | Boiling Point | 191-193°C | |
| Molecular Formula | C9H3ClF6O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 191-193°C | |
| Name | 2,4-bis(trifluoromethyl)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.512g/cm3 |
|---|---|
| Boiling Point | 191-193°C |
| Molecular Formula | C9H3ClF6O |
| Molecular Weight | 276.56300 |
| Flash Point | 191-193°C |
| Exact Mass | 275.97800 |
| PSA | 17.07000 |
| LogP | 4.10320 |
| Index of Refraction | 1.4323 |
| InChIKey | TZXHEDOCQVTEPT-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S23-S26-S36/37/39-S45 |
| RIDADR | 3265 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4-Bis(trifluoromethyl)benzoyl chloride |
| PC3103D |
| MFCD00061227 |