10-BROMO-2,2,6,6-TETRAMETHYL-2H-1,5,7-TRIOXA-PHENANTHREN-8-ONE structure
|
Common Name | 10-BROMO-2,2,6,6-TETRAMETHYL-2H-1,5,7-TRIOXA-PHENANTHREN-8-ONE | ||
|---|---|---|---|---|
| CAS Number | 531501-42-5 | Molecular Weight | 339.18100 | |
| Density | 1.419g/cm3 | Boiling Point | 472.8ºC at 760 mmHg | |
| Molecular Formula | C15H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.7ºC | |
| Name | 6-bromo-2,2,8,8-tetramethylpyrano[2,3-h][1,3]benzodioxin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.419g/cm3 |
|---|---|
| Boiling Point | 472.8ºC at 760 mmHg |
| Molecular Formula | C15H15BrO4 |
| Molecular Weight | 339.18100 |
| Flash Point | 239.7ºC |
| Exact Mass | 338.01500 |
| PSA | 44.76000 |
| LogP | 3.91860 |
| Index of Refraction | 1.556 |
| InChIKey | SLLYTDPSDVFHTF-UHFFFAOYSA-N |
| SMILES | CC1(C)C=Cc2c(c(Br)cc3c2OC(C)(C)OC3=O)O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10-bromo-2,2,6,6-tetramethyl-2H-1,5,7-trioxa-phenanthren-8-one |