1,2,3,4-CYCLOBUTANETETRACARBOXYLIC ACID structure
|
Common Name | 1,2,3,4-CYCLOBUTANETETRACARBOXYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 53159-92-5 | Molecular Weight | 232.144 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 439.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H8O8 | Melting Point | 242ºC | |
| MSDS | Chinese USA | Flash Point | 233.6±25.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,2,3,4-Cyclobutanetetracarboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 439.2±45.0 °C at 760 mmHg |
| Melting Point | 242ºC |
| Molecular Formula | C8H8O8 |
| Molecular Weight | 232.144 |
| Flash Point | 233.6±25.2 °C |
| Exact Mass | 232.021912 |
| PSA | 149.20000 |
| LogP | -1.10 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | CURBACXRQKTCKZ-UHFFFAOYSA-N |
| SMILES | O=C(O)C1C(C(=O)O)C(C(=O)O)C1C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | UN 1759 |
| Packaging Group | III |
| HS Code | 2917209090 |
|
~%
1,2,3,4-CYCLOBU... CAS#:53159-92-5 |
| Literature: US2006/89505 A1, ; Page/Page column 2 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
Synthesis, crystal structure, and magnetic characterization of the three-dimensional compound [Co2(cbut)(H2O)3]n (H4cbut = 1,2,3,4-cyclobutanetetracarboxylic acid).
Inorg. Chem. 53(11) , 5674-83, (2014) A novel cobalt(II) complex of formula [Co2(cbut)(H2O)3]n (1) (H4cbut = 1,2,3,4-cyclobutanetetracarboxylic acid) has been synthesized under hydrothermal conditions and its crystal structure has been de... |
|
|
Influence of configuration of carboxylic acid capping ligands on the salt-induced aggregation of gold clusters.
J. Colloid. Interface Sci. 283(2) , 440-5, (2005) Oxalic acid (Ox) and 1,2,3,4-cyclobutanetetracarboxylic acid (CBTCA) were employed as capping ligands in the preparation of gold colloids. FTIR indicated that Ox adopted a linear configuration through... |
| MFCD00013270 |
| Cyclobutane-1,2,3,4-tetracarboxylic acid |
| 1,2,3,4-CYCLOBUTANETETRACARBOXYLIC ACID |