N-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-chloroaniline structure
|
Common Name | N-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-chloroaniline | ||
|---|---|---|---|---|
| CAS Number | 5317-22-6 | Molecular Weight | 369.64100 | |
| Density | 1.42g/cm3 | Boiling Point | 457.5ºC at 760 mmHg | |
| Molecular Formula | C15H14BrClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.5ºC | |
| Name | N-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-4-chloroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 457.5ºC at 760 mmHg |
| Molecular Formula | C15H14BrClN2O2 |
| Molecular Weight | 369.64100 |
| Flash Point | 230.5ºC |
| Exact Mass | 367.99300 |
| PSA | 42.85000 |
| LogP | 4.63870 |
| Index of Refraction | 1.586 |
| InChIKey | NSRWIFPZBRGHRQ-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)c(C=NNc2ccc(Cl)cc2)cc1OC |
|
~%
N-[(2-bromo-4,5... CAS#:5317-22-6 |
| Literature: Woodward,R.B. et al. Journal of the American Chemical Society, 1966 , vol. 88, p. 852 - 853 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Bis-(2,2,2-Trichloraethyl)-d-tartrat |
| N-[(2-BROMO-4,5-DIMETHOXY-PHENYL)METHYLIDENEAMINO]-4-CHLORO-ANILINE |