2,2-Dichlorophenylacetic acid ethyl ester structure
|
Common Name | 2,2-Dichlorophenylacetic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5317-66-8 | Molecular Weight | 233.09100 | |
| Density | 1.278g/cm3 | Boiling Point | 284.1ºC at 760mmHg | |
| Molecular Formula | C10H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.5ºC | |
| Name | 2,3-dichlorophenylacetic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 284.1ºC at 760mmHg |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09100 |
| Flash Point | 112.5ºC |
| Exact Mass | 232.00600 |
| PSA | 26.30000 |
| LogP | 3.09900 |
| Index of Refraction | 1.527 |
| InChIKey | XNQDHXMQDHWHRU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cl)(Cl)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~81%
2,2-Dichlorophe... CAS#:5317-66-8 |
| Literature: McDonald, Richard N.; Cousins, Raymond C. Journal of Organic Chemistry, 1980 , vol. 45, # 15 p. 2976 - 2984 |
|
~%
2,2-Dichlorophe... CAS#:5317-66-8 |
| Literature: Lauritzen, Stein Erik; Roemming, Christian; Skatteboel, Lars Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1981 , vol. 35, # 4 p. 263 - 268 |
|
~%
2,2-Dichlorophe... CAS#:5317-66-8 |
| Literature: Claisen Chemische Berichte, 1879 , vol. 12, p. 633 Chemische Berichte, 1877 , vol. 10, p. 1663 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ethyl=2,2-dichloro-2-phenylacetate |
| ethyl 2,2-dichloro-2-phenyl-ethanoate |
| 2,2-DICHLORO-1-METHYL-CYCLOPROPANECARBOXYLIC ACID |
| 2.2-Dichlor-2-phenyl-essigsaeure-ethylester |
| Ethyl 2,3-dichlorophenylacetate |
| ethyl dichlorophenylacetate |
| Dichlor-phenyl-essigsaeure-aethylester |
| Ethyl 2,2-dichlorophenylacetate |
| ethyl phenyldichloroacetate |
| dichlorophenylacetic acid ethyl ester |
| DCPAE |
| 2,2-dichloro-2-phenyl-acetic acid ethyl ester |