N-(4-acetylphenyl)-4-methylbenzenesulfonamide structure
|
Common Name | N-(4-acetylphenyl)-4-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 5317-94-2 | Molecular Weight | 289.35000 | |
| Density | 1.278g/cm3 | Boiling Point | 462.1ºC at 760mmHg | |
| Molecular Formula | C15H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.3ºC | |
| Name | N-(4-acetylphenyl)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 462.1ºC at 760mmHg |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.35000 |
| Flash Point | 233.3ºC |
| Exact Mass | 289.07700 |
| PSA | 71.62000 |
| LogP | 4.15220 |
| Index of Refraction | 1.604 |
| InChIKey | FPXRFFCKWPPNEV-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
| HS Code | 2935009090 |
|---|
|
~96%
N-(4-acetylphen... CAS#:5317-94-2 |
| Literature: Kawamatsu; Sohda; Iami European Journal of Medicinal Chemistry, 1981 , vol. 16, # 4 p. 355 - 362 |
|
~92%
N-(4-acetylphen... CAS#:5317-94-2 |
| Literature: Deng, Wei; Liu, Lei; Zhang, Chen; Liu, Min; Guo, Qing-Xiang Tetrahedron Letters, 2005 , vol. 46, # 43 p. 7295 - 7298 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| n-(4-acetyl-phenyl)-4-methyl-benzenesulfonamide |
| 4-<N-(p-tolylsulfonyl)amino>acetophenone |
| p-(toluenesulfonamido)acetophenone |
| 4'-(4-toluenesulfonamido)acetophenone |
| 4-(p-toluenesulfonylamino)acetophenone |
| F1498-0032 |
| p-(N-p-tolylsulphonylamino)acetophenone |
| N-(4-acetylphenyl)-4-Methylbenzensulfonamide |