Diallyl Propyl Isocyanurate structure
|
Common Name | Diallyl Propyl Isocyanurate | ||
|---|---|---|---|---|
| CAS Number | 5320-25-2 | Molecular Weight | 251.28200 | |
| Density | 1.14 | Boiling Point | 136ºC / 2mmHg | |
| Molecular Formula | C12H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.3ºC | |
| Name | Diallyl Propyl Isocyanurate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14 |
|---|---|
| Boiling Point | 136ºC / 2mmHg |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.28200 |
| Flash Point | 151.3ºC |
| Exact Mass | 251.12700 |
| PSA | 66.00000 |
| Index of Refraction | 1.509 |
| InChIKey | ZIJDEADTCQKATN-UHFFFAOYSA-N |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCC)c1=O |
| Storage condition | 2-8°C |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,3-bis(prop-2-enyl)-5-propyl-1,3,5-triazinane-2,4,6-trione |
| Isocyanuric Acid Diallyl Propyl Ester |