2-Methyl-1-[4-(methylsulfonyl)phenyl]-1-propanone structure
|
Common Name | 2-Methyl-1-[4-(methylsulfonyl)phenyl]-1-propanone | ||
|---|---|---|---|---|
| CAS Number | 53207-59-3 | Molecular Weight | 226.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methyl-1-[4-(methylsulfonyl)phenyl]-1-propanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14O3S |
|---|---|
| Molecular Weight | 226.29200 |
| Exact Mass | 226.06600 |
| PSA | 59.59000 |
| LogP | 3.00960 |
| InChIKey | FDCUGWDQOGIBGG-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)c1ccc(S(C)(=O)=O)cc1 |
|
~%
2-Methyl-1-[4-(... CAS#:53207-59-3 |
| Literature: Daruwala,A.B. et al. Journal of Medicinal Chemistry, 1974 , vol. 17, # 8 p. 819 - 824 |
|
~%
2-Methyl-1-[4-(... CAS#:53207-59-3 |
| Literature: Daruwala,A.B. et al. Journal of Medicinal Chemistry, 1974 , vol. 17, # 8 p. 819 - 824 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methyl-1-(4-methylsulfonylphenyl)propan-1-one |