(4-Chlorophenyl)(4-piperidinyl)methanone structure
|
Common Name | (4-Chlorophenyl)(4-piperidinyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 53220-41-0 | Molecular Weight | 223.699 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 356.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C12H14ClNO | Melting Point | N/A | |
| MSDS | USA | Flash Point | 169.2±25.1 °C | |
| Name | (4-Chlorophenyl)(piperidin-4-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 356.2±32.0 °C at 760 mmHg |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.699 |
| Flash Point | 169.2±25.1 °C |
| Exact Mass | 223.076385 |
| PSA | 29.10000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | IYGWDOXHCPQXKN-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)C1CCNCC1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4-chlorophenyl)-piperidin-4-ylmethanone |
| 4-(4-Chlorobenzoyl)piperidine |
| Methanone, (4-chlorophenyl)-4-piperidinyl- |
| MFCD04113538 |
| (4-Chlorophenyl)(piperidin-4-yl)methanone |
| (4-Chlorophenyl)(4-piperidinyl)methanone |