2,5-diethyl-4-hydroxy-3,4-diphenyl-cyclopent-2-en-1-one structure
|
Common Name | 2,5-diethyl-4-hydroxy-3,4-diphenyl-cyclopent-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 5323-83-1 | Molecular Weight | 306.39800 | |
| Density | 1.12g/cm3 | Boiling Point | 409.7ºC at 760 mmHg | |
| Molecular Formula | C21H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.9ºC | |
| Name | 2,5-diethyl-4-hydroxy-3,4-diphenylcyclopent-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 409.7ºC at 760 mmHg |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.39800 |
| Flash Point | 174.9ºC |
| Exact Mass | 306.16200 |
| PSA | 37.30000 |
| LogP | 4.34690 |
| Index of Refraction | 1.586 |
| InChIKey | KGUWKIWUSQALLK-UHFFFAOYSA-N |
| SMILES | CCC1=C(c2ccccc2)C(O)(c2ccccc2)C(CC)C1=O |
|
~%
2,5-diethyl-4-h... CAS#:5323-83-1 |
| Literature: Japp; Meldrum Journal of the Chemical Society, 1901 , vol. 79, p. 1033 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,5-diethyl-4-hydroxy-3,4-diphenyl-cyclopent-2-enone |
| 2,5-Diaethyl-4-hydroxy-3,4-diphenyl-cyclopent-2-enon |
| 2,5-Diethyl-3,4-diphenyl-4-hydroxy-2-cyclopenten-1-one |