Morpholine,4,4'-sulfonylbis- structure
|
Common Name | Morpholine,4,4'-sulfonylbis- | ||
|---|---|---|---|---|
| CAS Number | 5328-68-7 | Molecular Weight | 236.28900 | |
| Density | 1.39g/cm3 | Boiling Point | 401.7ºC at 760 mmHg | |
| Molecular Formula | C8H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | 4-morpholin-4-ylsulfonylmorpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 401.7ºC at 760 mmHg |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.28900 |
| Flash Point | 196.7ºC |
| Exact Mass | 236.08300 |
| PSA | 67.46000 |
| Index of Refraction | 1.564 |
| InChIKey | SOBXUYMZUBUAOG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(N1CCOCC1)N1CCOCC1 |
| HS Code | 2934999090 |
|---|
|
~70%
Morpholine,4,4'... CAS#:5328-68-7 |
| Literature: Gavernet, Luciana; Dominguez Cabrera, M. Josefina; Bruno-Blanch, Luis E.; Estiu, Guillermina L. Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 3 p. 1556 - 1567 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4'-sulfonyl-bis-morpholine |
| 4,4'-sulfonyldimorpholine |
| Dimorpholino-sulfon |
| Sulfmorpholid |