(4-chlorophenyl) 3,4-dimethoxybenzoate
Modify Date: 2025-08-29 19:58:27
(4-chlorophenyl) 3,4-dimethoxybenzoate structure
|
Common Name | (4-chlorophenyl) 3,4-dimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 5329-91-9 | Molecular Weight | 280.31800 | |
| Density | 1.231g/cm3 | Boiling Point | 495.4ºC at 760 mmHg | |
| Molecular Formula | C18H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.5ºC | |
| Name | 1-(6-acetyl-7-hydroxy-9,10-dihydrophenanthren-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 495.4ºC at 760 mmHg |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.31800 |
| Flash Point | 267.5ºC |
| Exact Mass | 280.11000 |
| PSA | 54.37000 |
| LogP | 3.56300 |
| Index of Refraction | 1.623 |
| InChIKey | HQDVPDPWKZZJAF-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)CCc1cc(O)c(C(C)=O)cc1-2 |
|
~%
(4-chlorophenyl... CAS#:5329-91-9 |
| Literature: Mosettig; Stuart Journal of the American Chemical Society, 1939 , vol. 61, p. 1,4 |
|
~%
Detail
|
| Literature: Mosettig; Stuart Journal of the American Chemical Society, 1939 , vol. 61, p. 1,4 |
![1-(2-hydroxy-9,10-dihydro-[3]phenanthryl)-ethanone structure](https://image.chemsrc.com/caspic/352/859984-15-9.png)
| 3,7-Diacetyl-9,10-dihydro-[2]phenanthrol |
| 7-hydroxy-2,6-diacetyl-9,10-dihydrophenanthrene |
| 1,1'-(7-hydroxy-9,10-dihydrophenanthrene-2,6-diyl)diethanone |