1-dimethylaminopropan-2-yl N-phenylcarbamate structure
|
Common Name | 1-dimethylaminopropan-2-yl N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 5330-41-6 | Molecular Weight | 222.28400 | |
| Density | 1.097g/cm3 | Boiling Point | 277.1ºC at 760 mmHg | |
| Molecular Formula | C12H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.4ºC | |
| Name | 1-(dimethylamino)propan-2-yl N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 277.1ºC at 760 mmHg |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.28400 |
| Flash Point | 121.4ºC |
| Exact Mass | 222.13700 |
| PSA | 41.57000 |
| LogP | 2.25820 |
| Index of Refraction | 1.549 |
| InChIKey | HTAXCBIPSABVFQ-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)OC(=O)Nc1ccccc1 |
|
~%
1-dimethylamino... CAS#:5330-41-6 |
| Literature: Murdock,K.C. Journal of Organic Chemistry, 1968 , vol. 33, # 4 p. 1367 - 1371 |
|
~%
1-dimethylamino... CAS#:5330-41-6 |
| Literature: Murdock,K.C. Journal of Organic Chemistry, 1968 , vol. 33, # 4 p. 1367 - 1371 |
|
~%
1-dimethylamino... CAS#:5330-41-6 |
| Literature: Merrell Co. Patent: US2409001 , 1943 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Dimethylamino-2-phenylcarbamoyloxy-propan |
| N-phenyl-carbamic acid (2-dimethylamino-1-methyl-ethyl) ester |
| PHENYLCARBAMIC ACID,2-(DIMETHYLAMINO)-1-METHYLETHYL ESTER |
| N-Phenyl-carbaminsaeure-<1-dimethylamino-propyl-(2)>-ester |