1-phenoxypropan-2-yl N-phenylcarbamate structure
|
Common Name | 1-phenoxypropan-2-yl N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 6629-48-7 | Molecular Weight | 271.31100 | |
| Density | 1.176g/cm3 | Boiling Point | 374.1ºC at 760 mmHg | |
| Molecular Formula | C16H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | 1-phenoxypropan-2-yl N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 374.1ºC at 760 mmHg |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.31100 |
| Flash Point | 180ºC |
| Exact Mass | 271.12100 |
| PSA | 47.56000 |
| LogP | 3.77560 |
| Index of Refraction | 1.589 |
| InChIKey | CEMMFWQMZLORBN-UHFFFAOYSA-N |
| SMILES | CC(COc1ccccc1)OC(=O)Nc1ccccc1 |
|
~%
1-phenoxypropan... CAS#:6629-48-7 |
| Literature: Sexton; Britton Journal of the American Chemical Society, 1948 , vol. 70, p. 3606 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Phenoxy-2-phenylcarbamoyloxy-propan |
| 1-phenoxypropan-2-yl phenylcarbamate |
| HMS3088J14 |