diethyl 2-but-3-enyl-2-methyl-propanedioate
Modify Date: 2025-08-25 11:50:11
diethyl 2-but-3-enyl-2-methyl-propanedioate structure
|
Common Name | diethyl 2-but-3-enyl-2-methyl-propanedioate | ||
|---|---|---|---|---|
| CAS Number | 5331-70-4 | Molecular Weight | 228.28500 | |
| Density | 0.998g/cm3 | Boiling Point | 281ºC at 760 mmHg | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.3ºC | |
| Name | diethyl 2-but-3-enyl-2-methylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.998g/cm3 |
|---|---|
| Boiling Point | 281ºC at 760 mmHg |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.28500 |
| Flash Point | 128.3ºC |
| Exact Mass | 228.13600 |
| PSA | 52.60000 |
| LogP | 2.08510 |
| Index of Refraction | 1.445 |
| InChIKey | FXXKYZMPONDNNT-UHFFFAOYSA-N |
| SMILES | C=CCCC(C)(C(=O)OCC)C(=O)OCC |
| HS Code | 2917190090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| But-3-enyl-methyl-malonsaeure-diaethylester |
| 1-HEXENE-5,DIETHYL ESTER |
| but-3-enyl-methyl-malonic acid diethyl ester |