5-nitronaphthalene-1-carbonyl chloride
Modify Date: 2026-03-16 17:06:42
5-nitronaphthalene-1-carbonyl chloride structure
|
Common Name | 5-nitronaphthalene-1-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 5333-16-4 | Molecular Weight | 235.62300 | |
| Density | 1.456g/cm3 | Boiling Point | 385.5ºC at 760 mmHg | |
| Molecular Formula | C11H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.9ºC | |
| Name | 5-nitronaphthalene-1-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 385.5ºC at 760 mmHg |
| Molecular Formula | C11H6ClNO3 |
| Molecular Weight | 235.62300 |
| Flash Point | 186.9ºC |
| Exact Mass | 235.00400 |
| PSA | 62.89000 |
| LogP | 3.65020 |
| Index of Refraction | 1.676 |
| InChIKey | SKOUMIMRECKBJZ-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cccc2c([N+](=O)[O-])cccc12 |
| HS Code | 2916399090 |
|---|
|
~%
5-nitronaphthal... CAS#:5333-16-4 |
| Literature: Blicke; Parke Journal of the American Chemical Society, 1939 , vol. 61, p. 1200,1201 |
|
~%
5-nitronaphthal... CAS#:5333-16-4 |
| Literature: Nakayama; Okutome; Matsui; Kurumi; Sakurai; Aoyama; Fujii Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 3968 - 3980 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
Total 1, Current Page 1 of 1
1
| 5-nitro-1-naphthoic acid chloride |