methyl 4-oxo-2-phenyl-4-(4-phenylphenyl)butanoate
Modify Date: 2025-09-22 17:21:13
methyl 4-oxo-2-phenyl-4-(4-phenylphenyl)butanoate structure
|
Common Name | methyl 4-oxo-2-phenyl-4-(4-phenylphenyl)butanoate | ||
|---|---|---|---|---|
| CAS Number | 5333-39-1 | Molecular Weight | 344.40300 | |
| Density | 1.145g/cm3 | Boiling Point | 519.4ºC at 760 mmHg | |
| Molecular Formula | C23H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.3ºC | |
| Name | methyl 4-oxo-2-phenyl-4-(4-phenylphenyl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 519.4ºC at 760 mmHg |
| Molecular Formula | C23H20O3 |
| Molecular Weight | 344.40300 |
| Flash Point | 227.3ºC |
| Exact Mass | 344.14100 |
| PSA | 43.37000 |
| LogP | 4.88320 |
| Index of Refraction | 1.586 |
| InChIKey | KEJILQKPDRGJCH-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC(=O)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~%
methyl 4-oxo-2-... CAS#:5333-39-1 |
| Literature: Allen; Normington; Wilson Canadian Journal of Research, 1934 , vol. 11, p. 386 Chem. Zentralbl., 1935 , vol. 106, # I p. 893 |
![[1,1'-Biphenyl]-4-butanenitrile,g-oxo-a-phenyl- structure](https://image.chemsrc.com/caspic/252/63472-03-7.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-biphenyl-4-yl-4-oxo-2-phenyl-butyric acid methyl ester |
| 4-Biphenyl-4-yl-4-oxo-2-phenyl-buttersaeure-methylester |
| methyl 4-(biphenyl-4-yl)-4-oxo-2-phenylbutanoate |