[1,1'-Biphenyl]-4-butanenitrile,g-oxo-a-phenyl- structure
|
Common Name | [1,1'-Biphenyl]-4-butanenitrile,g-oxo-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 63472-03-7 | Molecular Weight | 311.37600 | |
| Density | 1.136g/cm3 | Boiling Point | 526ºC at 760 mmHg | |
| Molecular Formula | C22H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.9ºC | |
| Name | 4-oxo-2-phenyl-4-(4-phenylphenyl)butanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136g/cm3 |
|---|---|
| Boiling Point | 526ºC at 760 mmHg |
| Molecular Formula | C22H17NO |
| Molecular Weight | 311.37600 |
| Flash Point | 271.9ºC |
| Exact Mass | 311.13100 |
| PSA | 40.86000 |
| LogP | 5.23378 |
| Index of Refraction | 1.606 |
| InChIKey | XWRBNQWXBPDGNT-UHFFFAOYSA-N |
| SMILES | N#CC(CC(=O)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
|
~%
[1,1'-Biphenyl]... CAS#:63472-03-7 |
| Literature: Child; Osterberg; Sloboda; Tomcufcik Journal of Pharmaceutical Sciences, 1977 , vol. 66, # 4 p. 466 - 476 |
|
~%
[1,1'-Biphenyl]... CAS#:63472-03-7 |
| Literature: Allen; Normington; Wilson Canadian Journal of Research, 1934 , vol. 11, p. 386 Chem. Zentralbl., 1935 , vol. 106, # I p. 893 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| (+-)-4-Oxo-2-phenyl-4-(biphenylyl-(4))-buttersaeure-nitril |
| 4-biphenyl-4-yl-4-oxo-2-phenyl-butyronitrile |