1H-Pyrazolo[3,4-d]pyrimidin-4-amine,N-(3-chlorophenyl)-1-methyl- structure
|
Common Name | 1H-Pyrazolo[3,4-d]pyrimidin-4-amine,N-(3-chlorophenyl)-1-methyl- | ||
|---|---|---|---|---|
| CAS Number | 5334-67-8 | Molecular Weight | 259.69400 | |
| Density | 1.45g/cm3 | Boiling Point | 447ºC at 760 mmHg | |
| Molecular Formula | C12H10ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.1ºC | |
| Name | 4-[(m-chlorophenyl)amino]-1-methyl-1h-pyrazolo[3,4-d]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 447ºC at 760 mmHg |
| Molecular Formula | C12H10ClN5 |
| Molecular Weight | 259.69400 |
| Flash Point | 224.1ºC |
| Exact Mass | 259.06200 |
| PSA | 55.63000 |
| LogP | 2.83330 |
| Index of Refraction | 1.724 |
| InChIKey | ZCCRCOUBJLJMJO-UHFFFAOYSA-N |
| SMILES | Cn1ncc2c(Nc3cccc(Cl)c3)ncnc21 |
| HS Code | 2933990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (3-Chlor-phenoxy)-essigsaeure-anilid |
| (3-chloro-phenyl)-(1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-amine |
| (3-chloro-phenoxy)-acetic acid anilide |
| (3-Chlor-phenyl)-(1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-amin |