[1,1'-Biphenyl]-2-ol,3,5-dichloro- structure
|
Common Name | [1,1'-Biphenyl]-2-ol,3,5-dichloro- | ||
|---|---|---|---|---|
| CAS Number | 5335-24-0 | Molecular Weight | 239.09700 | |
| Density | 1.35g/cm3 | Boiling Point | 336.5ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133ºC | |
| Name | 2,4-dichloro-6-phenylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 336.5ºC at 760 mmHg |
| Molecular Formula | C12H8Cl2O |
| Molecular Weight | 239.09700 |
| Flash Point | 133ºC |
| Exact Mass | 237.99500 |
| PSA | 20.23000 |
| LogP | 4.36600 |
| Index of Refraction | 1.624 |
| InChIKey | AFXPPGXJWHJULD-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(Cl)cc1-c1ccccc1 |
CHEMICAL IDENTIFICATION
|
| HS Code | 2907199090 |
|---|
|
~87%
[1,1'-Biphenyl]... CAS#:5335-24-0 |
| Literature: Jendralla; Granzer; V Kerekjarto; Krause; Schacht; Baader; Bartmann; Beck; Bergmann; Kessler; Wess; Chen; Granata; Herchen; Kleine; Schussler; Wagner Journal of Medicinal Chemistry, 1991 , vol. 34, # 10 p. 2962 - 2983 |
|
~%
[1,1'-Biphenyl]... CAS#:5335-24-0 |
| Literature: Uto, Kensaku; Miyazawa, Etsuko; Ito, Katsuhiro; Sakamoto, Takeshi; Kikugawa, Yasuo Heterocycles, 1998 , vol. 48, # 12 p. 2593 - 2600 |
|
~%
[1,1'-Biphenyl]... CAS#:5335-24-0 |
| Literature: Squibb and Sons Patent: US1989081 , 1930 ; |
|
~%
Detail
|
| Literature: Squibb and Sons Patent: US1989081 , 1930 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907199090 |
|---|---|
| Summary | 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Caswell No. 323E |
| 3,5-Dichloro-2-hydroxybiphenyl |
| 3,5-dichloro-biphenyl-2-ol |
| 4.6-Dichlor-2-phenyl-phenol |
| 3,5-Dichlor-biphenyl-2-ol |
| 4,6-Dichloro-2-phenylphenol |
| 3.5-Dichlor-2-hydroxy-biphenyl |
| 3,5-Dichloro-2-biphenylol |
| 2-Hydroxy-3,5-dichlorobiphenyl |
| 2-Biphenylol,3,5-dichloro |
| 4,6-Dichloro-o-phenylphenol |