[1,1'-Biphenyl]-2-ol,3,5-dibromo- structure
|
Common Name | [1,1'-Biphenyl]-2-ol,3,5-dibromo- | ||
|---|---|---|---|---|
| CAS Number | 55815-20-8 | Molecular Weight | 327.99900 | |
| Density | 1.768g/cm3 | Boiling Point | 330.4ºC at 760 mmHg | |
| Molecular Formula | C12H8Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.6ºC | |
| Name | 2,4-dibromo-6-phenylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.768g/cm3 |
|---|---|
| Boiling Point | 330.4ºC at 760 mmHg |
| Molecular Formula | C12H8Br2O |
| Molecular Weight | 327.99900 |
| Flash Point | 153.6ºC |
| Exact Mass | 325.89400 |
| PSA | 20.23000 |
| LogP | 4.58420 |
| Index of Refraction | 1.655 |
| InChIKey | FLAJYIKIPQZYAY-UHFFFAOYSA-N |
| SMILES | Oc1c(Br)cc(Br)cc1-c1ccccc1 |
| HS Code | 2907199090 |
|---|
|
~%
[1,1'-Biphenyl]... CAS#:55815-20-8 |
| Literature: Squibb and Sons Patent: US1989081 , 1930 ; |
|
~%
[1,1'-Biphenyl]... CAS#:55815-20-8 |
| Literature: Hazlet; Kornberg Journal of the American Chemical Society, 1941 , vol. 63, p. 1890 |
|
~%
[1,1'-Biphenyl]... CAS#:55815-20-8 |
| Literature: Hazlet; Kornberg Journal of the American Chemical Society, 1941 , vol. 63, p. 1890 |
|
~%
Detail
|
| Literature: v. Auwers; Wittig Journal fuer Praktische Chemie (Leipzig), 1924 , vol. <2> 108, p. 103 |
| HS Code | 2907199090 |
|---|---|
| Summary | 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4.6-Dibrom-2-phenyl-phenol |
| 3,5-Dibromo-2-hydroxybiphenyl |
| 3,5-dibromobiphenyl-2-ol |
| 3.5-Dibrom-2-hydroxy-biphenyl |
| 4,6-dibromo-2-phenylphenol |
| 3,5-Dibrom-biphenyl-2-ol |