trans,trans-Bis(4-fluorobenzal)acetone structure
|
Common Name | trans,trans-Bis(4-fluorobenzal)acetone | ||
|---|---|---|---|---|
| CAS Number | 53369-00-9 | Molecular Weight | 270.27300 | |
| Density | 1.221g/cm3 | Boiling Point | 398.6ºC at 760mmHg | |
| Molecular Formula | C17H12F2O | Melting Point | 141-146ºC | |
| MSDS | N/A | Flash Point | 151.8ºC | |
| Name | 1,5-bis(4-fluorophenyl)penta-1,4-dien-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 398.6ºC at 760mmHg |
| Melting Point | 141-146ºC |
| Molecular Formula | C17H12F2O |
| Molecular Weight | 270.27300 |
| Flash Point | 151.8ºC |
| Exact Mass | 270.08600 |
| PSA | 17.07000 |
| LogP | 4.26050 |
| Index of Refraction | 1.618 |
| InChIKey | BNHFGYIPXPENKA-YDWXAUTNSA-N |
| SMILES | O=C(C=Cc1ccc(F)cc1)C=Cc1ccc(F)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| HS Code | 2914700090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| trans,trans-1,5-Bis(4-fluorophenyl)-1,4-pentadien-3-one |
| trans,trans-Bis(4-fluorobenzylidene)acetone |
| trans,trans-Bis(4-fluorobenzal)acetone |
| (1E,4E)-1,5-bis(4-fluorophenyl)-1,4-pentadien-3-one |
| 1,5-[bis(4-fluorophenyl)]-1,4-pentadien-3-one |
| (1E,4E)-1,5-bis(4-fluorophenyl)-1,4-pentadiene-3-one |