4-Phenyl-5-(phenylimino)-1,2,4-dithiazolidin-3-one structure
|
Common Name | 4-Phenyl-5-(phenylimino)-1,2,4-dithiazolidin-3-one | ||
|---|---|---|---|---|
| CAS Number | 5338-82-9 | Molecular Weight | 286.37200 | |
| Density | 1.33g/cm3 | Boiling Point | 427.9ºC at 760 mmHg | |
| Molecular Formula | C14H10N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.6ºC | |
| Name | 4-phenyl-5-phenylimino-1,2,4-dithiazolidin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 427.9ºC at 760 mmHg |
| Molecular Formula | C14H10N2OS2 |
| Molecular Weight | 286.37200 |
| Flash Point | 212.6ºC |
| Exact Mass | 286.02300 |
| PSA | 90.84000 |
| LogP | 3.19290 |
| Index of Refraction | 1.7 |
| InChIKey | DFLOFYMDVXZMON-UHFFFAOYSA-N |
| SMILES | O=c1ssc(=Nc2ccccc2)n1-c1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: Antimalarial activity against chloroquine-sensitive Plasmodium falciparum W2 by [3H]h...
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL944269
|
|
Name: Inhibition of Plasmodium falciparum KAS3 expressed in Escherichia coli assessed as tr...
Source: ChEMBL
Target: N/A
External Id: CHEMBL944268
|
|
Name: Antimalarial activity against chloroquine-resistant Plasmodium falciparum D6 by [3H]h...
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL944270
|
| (5z)-4-phenyl-5-(phenylimino)-1,2,4-dithiazolidin-3-one |
| 4-Phenyl-5-phenylimino-[1,2,4]dithiazolidin-3-on |
| 4-phenyl-5-phenylimino-[1,2,4]dithiazolidin-3-one |