N-[2-(2-nitrophenyl)ethyl]propan-1-amine structure
|
Common Name | N-[2-(2-nitrophenyl)ethyl]propan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 5339-08-2 | Molecular Weight | 208.25700 | |
| Density | 1.082g/cm3 | Boiling Point | 310.9ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.8ºC | |
| Name | dimethyl[2-(2-nitrophenyl)ethyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.082g/cm3 |
|---|---|
| Boiling Point | 310.9ºC at 760 mmHg |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.25700 |
| Flash Point | 141.8ºC |
| Exact Mass | 208.12100 |
| PSA | 57.85000 |
| LogP | 3.05100 |
| Index of Refraction | 1.534 |
| InChIKey | NATOCEDSZBLLGG-UHFFFAOYSA-N |
| SMILES | CCCNCCc1ccccc1[N+](=O)[O-] |
| HS Code | 2921199090 |
|---|
|
~%
N-[2-(2-nitroph... CAS#:5339-08-2 |
| Literature: Frontana-Uribe; Moinet; Toupet European Journal of Organic Chemistry, 1999 , # 2 p. 419 - 430 |
|
~%
N-[2-(2-nitroph... CAS#:5339-08-2 |
| Literature: Frontana-Uribe; Moinet; Toupet European Journal of Organic Chemistry, 1999 , # 2 p. 419 - 430 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (2-nitro-phenethyl)-malonic acid dimethyl ester |
| N-(ortho-nitrophenyl)propylamine |
| (2-nitro-phenethyl)-propyl-amine |
| (2-Nitro-phenaethyl)-malonsaeure-dimethylester |
| (2-Nitro-phenaethyl)-propyl-amin |