1H-Pyrrolo[2,3-b]pyridine-3-methanamine,6-ethyl-N,N-dimethyl-(9CI) structure
|
Common Name | 1H-Pyrrolo[2,3-b]pyridine-3-methanamine,6-ethyl-N,N-dimethyl-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 533939-05-8 | Molecular Weight | 203.28300 | |
| Density | 1.101g/cm3 | Boiling Point | 317.9ºC at 760 mmHg | |
| Molecular Formula | C12H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.1ºC | |
| Name | 1-(6-ethyl-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,N-dimethylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 317.9ºC at 760 mmHg |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.28300 |
| Flash Point | 146.1ºC |
| Exact Mass | 203.14200 |
| PSA | 31.92000 |
| LogP | 2.18690 |
| Index of Refraction | 1.611 |
| InChIKey | GUHVWEHQCSJGGA-UHFFFAOYSA-N |
| SMILES | CCc1ccc2c(CN(C)C)c[nH]c2n1 |
|
~%
1H-Pyrrolo[2,3-... CAS#:533939-05-8 |
| Literature: Van Zandt, Michael C.; Doan, Brian; Sawicki, Diane R.; Sredy, Janet; Podjarny, Alberto D. Bioorganic and Medicinal Chemistry Letters, 2009 , vol. 19, # 7 p. 2006 - 2008 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1H-Pyrrolo[2,3-b]pyridine-3-methanamine,6-ethyl-N,N-dimethyl |
| 6-ethyl-1H-pyrrolo[2,3-b]pyridin-3-ylmethyl-dimethyl-amine |