1-(4-chlorophenyl)-N-(4-nitrophenyl)methanimine structure
|
Common Name | 1-(4-chlorophenyl)-N-(4-nitrophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 5340-14-7 | Molecular Weight | 260.67600 | |
| Density | 1.27g/cm3 | Boiling Point | 422.5ºC at 760 mmHg | |
| Molecular Formula | C13H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.3ºC | |
| Name | 1-(4-chlorophenyl)-N-(4-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 422.5ºC at 760 mmHg |
| Molecular Formula | C13H9ClN2O2 |
| Molecular Weight | 260.67600 |
| Flash Point | 209.3ºC |
| Exact Mass | 260.03500 |
| PSA | 58.18000 |
| LogP | 4.52200 |
| Index of Refraction | 1.608 |
| InChIKey | SAQJFGNBQLBYDF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=Cc2ccc(Cl)cc2)cc1 |
|
~97%
1-(4-chlorophen... CAS#:5340-14-7 |
| Literature: Schmeyers, Jens; Toda, Fumio; Boy, Juergen; Kaupp, Gerd Journal of the Chemical Society. Perkin Transactions 2, 1998 , # 4 p. 989 - 993 |
| 4'-Chlor-4-nitro-azomethin |
| p-chlorobenzylidene-(4-nitrophenyl)-amine |