bis(3-amino-4-dimethylamino-phenyl)methanone structure
|
Common Name | bis(3-amino-4-dimethylamino-phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 5340-23-8 | Molecular Weight | 298.38300 | |
| Density | 1.202g/cm3 | Boiling Point | 541.6ºC at 760 mmHg | |
| Molecular Formula | C17H22N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.3ºC | |
| Name | bis[3-amino-4-(dimethylamino)phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 541.6ºC at 760 mmHg |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.38300 |
| Flash Point | 281.3ºC |
| Exact Mass | 298.17900 |
| PSA | 75.59000 |
| LogP | 3.37640 |
| Index of Refraction | 1.674 |
| InChIKey | OSABJXFEGLRNTG-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)c2ccc(N(C)C)c(N)c2)cc1N |
| HS Code | 2922399090 |
|---|
|
~%
bis(3-amino-4-d... CAS#:5340-23-8 |
| Literature: Kliegl Chemische Berichte, 1906 , vol. 39, p. 1274 |
|
~%
bis(3-amino-4-d... CAS#:5340-23-8 |
| Literature: Kliegl Chemische Berichte, 1906 , vol. 39, p. 1274 |
|
~%
bis(3-amino-4-d... CAS#:5340-23-8 |
| Literature: Kliegl Chemische Berichte, 1906 , vol. 39, p. 1274 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,3'-diamino-4,4'-bis-dimethylamino-benzophenone |