Isomethadone Hydrochloride structure
|
Common Name | Isomethadone Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 5341-49-1 | Molecular Weight | 345.90600 | |
| Density | 1.009g/cm3 | Boiling Point | 423.7ºC at 760mmHg | |
| Molecular Formula | C21H28ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.5ºC | |
| Name | Isomethadone Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.009g/cm3 |
|---|---|
| Boiling Point | 423.7ºC at 760mmHg |
| Molecular Formula | C21H28ClNO |
| Molecular Weight | 345.90600 |
| Flash Point | 126.5ºC |
| Exact Mass | 345.18600 |
| PSA | 20.31000 |
| LogP | 4.95150 |
| InChIKey | ZLZWUOKDFLNZFV-UHFFFAOYSA-N |
| SMILES | CCC(=O)C(c1ccccc1)(c1ccccc1)C(C)CN(C)C.Cl |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 6-(dimethylamino)-5-methyl-4,4-diphenylhexan-3-one,hydrochloride |