6-Methoxy-4-methyl-2-quinolinol structure
|
Common Name | 6-Methoxy-4-methyl-2-quinolinol | ||
|---|---|---|---|---|
| CAS Number | 5342-23-4 | Molecular Weight | 189.210 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 397.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.4±26.5 °C | |
| Name | 6-methoxy-4-methyl-1H-quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.8±37.0 °C at 760 mmHg |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.210 |
| Flash Point | 194.4±26.5 °C |
| Exact Mass | 189.078979 |
| PSA | 42.35000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | VGQWDNJRHAWUNX-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(=O)cc(C)c2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
|
~91%
6-Methoxy-4-met... CAS#:5342-23-4 |
| Literature: Rajendran, A.; Karthikeyan, C.; Rajathi, K.; Ragupathy, D. Journal of Chemical Sciences (Bangalore), 2012 , vol. 124, # 4 p. 877 - 881,5 |
|
~61%
6-Methoxy-4-met... CAS#:5342-23-4 |
| Literature: Liu, Ying; Feng, Yabing; Wang, Renxiao; Gao, Ying; Lai, Luhua Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 13 p. 1639 - 1641 |
|
~%
6-Methoxy-4-met... CAS#:5342-23-4 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 11, # 13 p. 1639 - 1641 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methoxy-4-methylquinolin-2-ol |
| 2-hydroxy-4-methyl-6-methoxyquinoline |
| 6-Methoxy-4-methyl-2-quinolinol |
| 6-Methoxy-2-hydroxylepidin |
| 6-Methoxy-4-methyl-chinolin-2-ol |
| 6-Methoxy-4-methylcarbostyril |
| 2-quinolinol, 6-methoxy-4-methyl- |
| 2-Methyl-6-methoxychinolin-4-ol |
| 2-Hydroxy-6-methoxy-4-methyl-chinolin |
| 2-Hydroxy-6-methoxy-4-methylquinoline |