4-Chloro-1-naphthol acetate structure
|
Common Name | 4-Chloro-1-naphthol acetate | ||
|---|---|---|---|---|
| CAS Number | 53422-20-1 | Molecular Weight | 220.65200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-1-naphthyl acetate |
|---|
| Molecular Formula | C12H9ClO2 |
|---|---|
| Molecular Weight | 220.65200 |
| Exact Mass | 220.02900 |
| PSA | 26.30000 |
| LogP | 3.41850 |
| InChIKey | REQQYLRRDZGXFH-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(Cl)c2ccccc12 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |