Naphtho[1,2-c]furan-1,3-dione structure
|
Common Name | Naphtho[1,2-c]furan-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5343-99-7 | Molecular Weight | 198.17400 | |
| Density | 1.449g/cm3 | Boiling Point | 401.9ºC at 760 mmHg | |
| Molecular Formula | C12H6O3 | Melting Point | 170ºC | |
| MSDS | N/A | Flash Point | 203.1ºC | |
| Name | 1,2-Naphthalic Anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.449g/cm3 |
|---|---|
| Boiling Point | 401.9ºC at 760 mmHg |
| Melting Point | 170ºC |
| Molecular Formula | C12H6O3 |
| Molecular Weight | 198.17400 |
| Flash Point | 203.1ºC |
| Exact Mass | 198.03200 |
| PSA | 43.37000 |
| LogP | 2.15040 |
| Index of Refraction | 1.712 |
| InChIKey | IDVDAZFXGGNIDQ-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2c1ccc1ccccc21 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2917399090 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,2-NAPHTHALIC ANHYDRIDE |
| 1,2-Naphthalenedicarboxylic Anhydride |
| benzo[e][2]benzofuran-1,3-dione |