4-TRIFLUOROACETAMIDOANILINE
Modify Date: 2025-08-24 21:24:21
4-TRIFLUOROACETAMIDOANILINE structure
|
Common Name | 4-TRIFLUOROACETAMIDOANILINE | ||
|---|---|---|---|---|
| CAS Number | 53446-90-5 | Molecular Weight | 204.14900 | |
| Density | 1.445g/cm3 | Boiling Point | 218.4ºC at 760 mmHg | |
| Molecular Formula | C8H7F3N2O | Melting Point | 118ºC | |
| MSDS | Chinese USA | Flash Point | 85.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(4-aminophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.445g/cm3 |
|---|---|
| Boiling Point | 218.4ºC at 760 mmHg |
| Melting Point | 118ºC |
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | 204.14900 |
| Flash Point | 85.9ºC |
| Exact Mass | 204.05100 |
| PSA | 55.12000 |
| LogP | 2.42380 |
| Index of Refraction | 1.553 |
| InChIKey | DEXJVEPWTWVUNM-UHFFFAOYSA-N |
| SMILES | Nc1ccc(NC(=O)C(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
|
~77%
4-TRIFLUOROACET... CAS#:53446-90-5 |
| Literature: SCHERING AKTIENGESELLSCHAFT Patent: WO2004/48343 A1, 2004 ; Location in patent: Page 102; 106 ; WO 2004/048343 A1 |
|
~%
4-TRIFLUOROACET... CAS#:53446-90-5 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 70, # 8 p. 956 - 959 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![Hexadecanamide, N-(4-aminophenyl)-N-[4-(diethylamino)-1-methylbutyl] structure](https://image.chemsrc.com/caspic/384/79692-45-8.png)
CAS#:79692-45-8| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Kallin, E., et al.
Glycoconj. J. 3 , 311, (1986)
|
| 4'-Amino-2,2,2-trifluoracetanilid |
| p-trifluoroacetamidoaniline |
| N-(4-Amino-phenyl)-2,2,2-trifluoro-acetamide |
| 4-[(Trifluoroacetyl)amino]aniline |
| 2,2,2-trifluoro-N-(4-amino-phenyl)-acetamide |
| 4-(trifluoroacetamido)aniline |
| 4-Trifluoroacetyl-p-phenylenediamine |
| 4-trifluoracetyl-p-phenylenediamine |