N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethyl-benzenesulfonamide structure
|
Common Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 5345-19-7 | Molecular Weight | 309.31400 | |
| Density | 1.203g/cm3 | Boiling Point | 422.8ºC at 760 mmHg | |
| Molecular Formula | C15H19NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.9ºC | |
| Name | (o-nitrophenethyl)malonic acid, diethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 422.8ºC at 760 mmHg |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.31400 |
| Flash Point | 165.9ºC |
| Exact Mass | 309.12100 |
| PSA | 98.42000 |
| LogP | 2.79300 |
| Index of Refraction | 1.521 |
| InChIKey | MWGXEFCULTYOQJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCc1ccccc1[N+](=O)[O-])C(=O)OCC |
| HS Code | 2917190090 |
|---|
|
~87%
N-[2-chloro-5-(... CAS#:5345-19-7 |
| Literature: KALVINS, Ivars; LEBEDEVS, Antons; CHERNOBROVIJS, Aleksandrs; VEINBERG, Grigory; VORONA, Maksims; IEVINA, Agnija Patent: WO2010/64189 A1, 2010 ; Location in patent: Page/Page column 5 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzene,(2-nitropentyl) |
| (2-nitro-phenethyl)-malonic acid diethyl ester |
| (2-nitro-pentyl)-benzene |
| (2-Nitro-phenaethyl)-malonsaeure-diaethylester |
| (2-Nitro-pentyl)-benzol |