phenanthrene-3-sulfonic acid
Modify Date: 2025-09-11 19:24:53
phenanthrene-3-sulfonic acid structure
|
Common Name | phenanthrene-3-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 5345-99-3 | Molecular Weight | 281.28200 | |
| Density | 1.431g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H10NaO3S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-phenanthrenesulfonic acid, sodium salt |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Molecular Formula | C14H10NaO3S+ |
| Molecular Weight | 281.28200 |
| Exact Mass | 281.02500 |
| PSA | 62.75000 |
| LogP | 4.32050 |
| Index of Refraction | 1.732 |
| InChIKey | KCPGDEWIXXQYPR-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2ccc3ccccc3c2c1.[Na+] |
| HS Code | 2904100000 |
|---|
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| sodium phenanthrene-3-sulfonate |
| Phenanthren-3-sulfonsaeure-Na-Salz |
| Phenanthren-3-carbonsaeure-aethylester |
| phenanthrene-3-carboxylic acid ethyl ester |
| Phenanthren-carbonsaeure-(3)-ethylester |
| 3-Ethoxycarbonyl-phenanthren |