3-Phenanthrenesulfonic acid structure
|
Common Name | 3-Phenanthrenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 2039-95-4 | Molecular Weight | 258.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenanthrene-3-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10O3S |
|---|---|
| Molecular Weight | 258.29200 |
| Exact Mass | 258.03500 |
| PSA | 62.75000 |
| LogP | 4.32050 |
| InChIKey | DATCUBITXKHYTK-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2ccc3ccccc3c2c1 |
| HS Code | 2904100000 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
| Phenanthren-3-sulfonsaeure |