2β,6β,15α-Trihydroxy-ent-kaur-16-ene structure
|
Common Name | 2β,6β,15α-Trihydroxy-ent-kaur-16-ene | ||
|---|---|---|---|---|
| CAS Number | 53452-32-7 | Molecular Weight | 320.47 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 467.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.3±23.3 °C | |
Use of 2β,6β,15α-Trihydroxy-ent-kaur-16-ene2β,6β,15α-Trihydroxy-ent-kaur-16-ene (compound 19) is a compound isolated from the aerial parts of Pteris cretica[1]. |
| Name | 16-Kaurene-2,6,15-triol |
|---|---|
| Synonym | More Synonyms |
| Description | 2β,6β,15α-Trihydroxy-ent-kaur-16-ene (compound 19) is a compound isolated from the aerial parts of Pteris cretica[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.5±45.0 °C at 760 mmHg |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 |
| Flash Point | 211.3±23.3 °C |
| Exact Mass | 320.235138 |
| PSA | 60.69000 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | OUDUFOYDAUOXPD-UZHLRENFSA-N |
| SMILES | C=C1C2CCC3C4(C)CC(O)CC(C)(C)C4C(O)CC3(C2)C1O |
| Hazard Codes | Xi |
|---|
| (2β,5β,6β,8α,9β,10α,13α,15α)-Kaur-16-ene-2,6,15-triol |