creticoside c
creticoside c structure
|
Common Name | creticoside c | ||
|---|---|---|---|---|
| CAS Number | 53452-34-9 | Molecular Weight | 484.623 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 654.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H44O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349.5±31.5 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 654.3±55.0 °C at 760 mmHg |
| Molecular Formula | C26H44O8 |
| Molecular Weight | 484.623 |
| Flash Point | 349.5±31.5 °C |
| Exact Mass | 484.303619 |
| PSA | 139.84000 |
| LogP | 0.81 |
| Vapour Pressure | 0.0±4.5 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | RGKNTHMUHXNDHJ-JCIBFBKLSA-N |
| SMILES | CC1(C)CC(OC2OC(CO)C(O)C(O)C2O)CC2(C)C1C(O)CC13CC(CCC12)C(C)(O)C3 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucopyranoside |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside? |
| A: Polar surface area (PSA) of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside is 139.84000. |
| Q: What English synonyms does (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside have? |
| A: English synonyms of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside: (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucopyranoside. |
| Q: What is the SMILES notation of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside? |
| A: SMILES notation of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside is CC1(C)CC(OC2OC(CO)C(O)C(O)C2O)CC2(C)C1C(O)CC13CC(CCC12)C(C)(O)C3. |
| Q: What is the LogP of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside? |
| A: LogP of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside is 0.81. |
| Q: What is the CAS number of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside? |
| A: CAS number of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside is 53452-34-9. |
| Q: What is the English name of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside? |
| A: The English name of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside is (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside. |
| Q: What is the molecular weight of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside? |
| A: Molecular weight of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside is 484.623. |
| Q: What is the InChIKey of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside? |
| A: InChIKey of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside is RGKNTHMUHXNDHJ-JCIBFBKLSA-N. |
| Q: What is the molecular formula of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside? |
| A: Molecular formula of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside is C26H44O8. |
| Q: What is the boiling point of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside? |
| A: Boiling point of (2β,5β,6β,8α,9β,10α,13α,16β)-6,16-Dihydroxykauran-2-yl β-D-glucop yranoside is 654.3±55.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| Dayang Chem (Hangzhou) Co., Ltd. |
| naturewill |