4-(4-METHOXYPHENYL)-2-PHENYL-1H-IMIDAZOLE structure
|
Common Name | 4-(4-METHOXYPHENYL)-2-PHENYL-1H-IMIDAZOLE | ||
|---|---|---|---|---|
| CAS Number | 53458-08-5 | Molecular Weight | 250.29500 | |
| Density | 1.161g/cm3 | Boiling Point | 489.8ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O | Melting Point | 175-179ºC | |
| MSDS | Chinese USA | Flash Point | 174.3ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 5-(4-Methoxyphenyl)-2-phenyl-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 489.8ºC at 760 mmHg |
| Melting Point | 175-179ºC |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.29500 |
| Flash Point | 174.3ºC |
| Exact Mass | 250.11100 |
| PSA | 37.91000 |
| LogP | 3.75230 |
| Index of Refraction | 1.609 |
| InChIKey | ZJUBRROOFQATFF-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cnc(-c3ccccc3)[nH]2)cc1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-37/38-41 |
| Safety Phrases | 26-39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933290090 |
|
~49%
4-(4-METHOXYPHE... CAS#:53458-08-5 |
| Literature: Kumar, Dalip; Kumar, N. Maruthi; Patel, Gautam; Gupta, Sudeep; Varma, Rajender S. Tetrahedron Letters, 2011 , vol. 52, # 16 p. 1983 - 1986 |
|
~%
4-(4-METHOXYPHE... CAS#:53458-08-5 |
| Literature: Zuliani, Valentina; Cocconcelli, Giuseppe; Fantini, Marco; Ghiron, Chiara; Rivara, Mirko Journal of Organic Chemistry, 2007 , vol. 72, # 12 p. 4551 - 4553 |
|
~%
4-(4-METHOXYPHE... CAS#:53458-08-5 |
| Literature: Zuliani, Valentina; Fantini, Marco; Nigam, Aradhya; Stables, James P.; Patel, Manoj K.; Rivara, Mirko Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 22 p. 7957 - 7965 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-methoxy-phenyl)-2-phenyl-1H-imidazole |
| 1H-IMIDAZOLE,5-(4-METHOXYPHENYL)-2-PHENYL |
| 4-(4-methoxy-phenyl)-2-phenyl-1(3)H-imidazole |
| 4-(4-methoxyphenyl)-2-phenylimidazole |
| 2-phenyl-4(5)-(4-methoxyphenyl)imidazole |