2-acetamidonaphthalene-1-sulfonic acid
Modify Date: 2025-08-25 19:32:08
2-acetamidonaphthalene-1-sulfonic acid structure
|
Common Name | 2-acetamidonaphthalene-1-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 53460-20-1 | Molecular Weight | 265.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-acetamidonaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11NO4S |
|---|---|
| Molecular Weight | 265.28500 |
| Exact Mass | 265.04100 |
| PSA | 95.34000 |
| LogP | 3.77520 |
| InChIKey | YZUMYXYLMWRUEW-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2ccccc2c1S(=O)(=O)O |
|
~%
2-acetamidonaph... CAS#:53460-20-1 |
| Literature: Chen; Cross Journal of the Society of Dyers and Colourists, 1943 , vol. 59, p. 144,147 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Naphthalenesulfonic acid,2-(acetylamino) |
| 2-acetylamino-naphthalene-1-sulfonic acid |
| 2-Acetamino-naphthalin-sulfonsaeure-(1) |
| 2-Acetylamino-naphthalin-1-sulfonsaeure |