8-acetamidonaphthalene-1-sulfonic acid structure
|
Common Name | 8-acetamidonaphthalene-1-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 100362-96-7 | Molecular Weight | 265.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-acetamidonaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11NO4S |
|---|---|
| Molecular Weight | 265.28500 |
| Exact Mass | 265.04100 |
| PSA | 95.34000 |
| LogP | 3.77520 |
| InChIKey | HSZZZVHTYSQLNZ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc2cccc(S(=O)(=O)O)c12 |
|
~%
8-acetamidonaph... CAS#:100362-96-7 |
| Literature: Journal of the Society of Chemical Industry, London, , vol. 47, p. 156 T Chem. Zentralbl., , vol. 99, # II p. 768 |
|
~%
8-acetamidonaph... CAS#:100362-96-7 |
| Literature: DE75084 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 429 |
|
~%
Detail
|
| Literature: DE75084 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 429 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1-Naphthalenesulfonic acid,8-(acetylamino) |
| 8-acetylamino-naphthalene-1-sulfonic acid |
| N-Acetyl-naphthylamin-(1)-sulfonsaeure-(8) |
| 8-Acetylamino-naphthalin-1-sulfonsaeure |
| 8-Acetamino-naphthalin-sulfonsaeure-(1) |