2-anilino-5,5-diethyl-1-phenyl-pyrimidine-4,6-dione structure
|
Common Name | 2-anilino-5,5-diethyl-1-phenyl-pyrimidine-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 5347-02-4 | Molecular Weight | 335.40000 | |
| Density | 1.16g/cm3 | Boiling Point | 456ºC at 760 mmHg | |
| Molecular Formula | C20H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.6ºC | |
| Name | 5,5-Diaethyl-2-anilino-1-phenyl-1H-pyrimidin-4,6-dion |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 456ºC at 760 mmHg |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.40000 |
| Flash Point | 229.6ºC |
| Exact Mass | 335.16300 |
| PSA | 61.77000 |
| LogP | 4.03730 |
| Index of Refraction | 1.605 |
| InChIKey | DZQLVKJKSNUNOX-UHFFFAOYSA-N |
| SMILES | CCC1(CC)C(=O)NC(=Nc2ccccc2)N(c2ccccc2)C1=O |
|
~%
2-anilino-5,5-d... CAS#:5347-02-4 |
| Literature: Skinner; Wright Journal of the American Chemical Society, 1957 , vol. 79, p. 6204,6207 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,5-diethyl-2-anilino-1H-pyrimidine-4,6-dione |
| 5,5-Diethyl-2-phenyliminobarbituric acid |
| 5,5-Diaethyl-2-anilino-1H-pyrimidin-4,6-dion |
| 5,5-diethyl-2-anilino-1-phenyl-1H-pyrimidine-4,6-dione |