4-(4-chlorophenyl)-1,2-diphenyl-but-2-ene-1,4-dione structure
|
Common Name | 4-(4-chlorophenyl)-1,2-diphenyl-but-2-ene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 53476-32-7 | Molecular Weight | 346.80600 | |
| Density | 1.233g/cm3 | Boiling Point | 507.4ºC at 760 mmHg | |
| Molecular Formula | C22H15ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.2ºC | |
| Name | 4-(4-chlorophenyl)-1,2-diphenylbut-2-ene-1,4-dione |
|---|
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 507.4ºC at 760 mmHg |
| Molecular Formula | C22H15ClO2 |
| Molecular Weight | 346.80600 |
| Flash Point | 212.2ºC |
| Exact Mass | 346.07600 |
| PSA | 34.14000 |
| LogP | 5.48920 |
| Index of Refraction | 1.631 |
| InChIKey | PNZSYMGEZQXESH-HKWRFOASSA-N |
| SMILES | O=C(C=C(C(=O)c1ccccc1)c1ccccc1)c1ccc(Cl)cc1 |
|
~%
4-(4-chlorophen... CAS#:53476-32-7 |
| Literature: Nagaraj, Muthupandi; Iniya, Murugan; Boominathan, Muthusamy; Muthusubramanian, Shanmugam; Bhuvanesh, Nattamai Journal of Chemical Sciences (Bangalore), 2012 , vol. 124, # 4 p. 913 - 919,7 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |