Phenol,4-[[(2-nitrophenyl)methylene]amino]- structure
|
Common Name | Phenol,4-[[(2-nitrophenyl)methylene]amino]- | ||
|---|---|---|---|---|
| CAS Number | 5348-28-7 | Molecular Weight | 242.23000 | |
| Density | 1.25g/cm3 | Boiling Point | 460.6ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.4ºC | |
| Name | 4-[(2-nitrophenyl)methylideneamino]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 460.6ºC at 760 mmHg |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23000 |
| Flash Point | 232.4ºC |
| Exact Mass | 242.06900 |
| PSA | 78.41000 |
| LogP | 3.57420 |
| Index of Refraction | 1.613 |
| InChIKey | CDCHWCWDVQOMLH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1C=Nc1ccc(O)cc1 |
| HS Code | 2925290090 |
|---|
|
~60%
Phenol,4-[[(2-n... CAS#:5348-28-7 |
| Literature: Baluja, Shipra; Parikh, Jigna; Chanda, Sumitra; Vaishnani Journal of the Indian Chemical Society, 2009 , vol. 86, # 12 p. 1338 - 1342 |
|
~%
Phenol,4-[[(2-n... CAS#:5348-28-7 |
| Literature: Moehlau; Adam Zeitschrift f.Farbenindustrie, vol. 5, p. 404 Chem. Zentralbl., 1907 , vol. 78, # I p. 107 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(2-nitro-benzylidenamino)-phenol |
| 4-{[(2-nitrophenyl)methylene]amino}phenol |
| 4-(2-Nitro-benzalamino)-phenol |
| o-Nitrobenzaldehyd-p-hydroxyphenylimin |
| 4-[(2-Nitro-benzylidene)-amino]-phenol |
| 4-{[(E)-(2-nitrophenyl)methylidene]amino}phenol |
| N-<2-Nitro-benzyliden>-4-hydroxy-anilin |