dinitrate of 1,3-adamantanediol structure
|
Common Name | dinitrate of 1,3-adamantanediol | ||
|---|---|---|---|---|
| CAS Number | 53488-28-1 | Molecular Weight | 258.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dinitrate of 1,3-adamantanediol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14N2O6 |
|---|---|
| Molecular Weight | 258.22800 |
| Exact Mass | 258.08500 |
| PSA | 110.10000 |
| LogP | 2.54080 |
| InChIKey | XEKRSOZFGXQKEZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OC12CC3CC(C1)CC(O[N+](=O)[O-])(C3)C2 |
| 1,3-adamantanediol dinitrate |
| 1,3-adamantylene dinitrate |
| 1,3-dinitroxyadamantane |