1,3-Adamantanediacetic acid structure
|
Common Name | 1,3-Adamantanediacetic acid | ||
|---|---|---|---|---|
| CAS Number | 17768-28-4 | Molecular Weight | 252.306 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 453.9±18.0 °C at 760 mmHg | |
| Molecular Formula | C14H20O4 | Melting Point | 234-237 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 242.5±17.7 °C | |
| Name | 2-[3-(carboxymethyl)-1-adamantyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 453.9±18.0 °C at 760 mmHg |
| Melting Point | 234-237 °C(lit.) |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.306 |
| Flash Point | 242.5±17.7 °C |
| Exact Mass | 252.136154 |
| PSA | 74.60000 |
| LogP | 2.04 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | UTENGZNBNPABQE-UHFFFAOYSA-N |
| SMILES | O=C(O)CC12CC3CC(C1)CC(CC(=O)O)(C3)C2 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917209090 |
| Precursor 7 | |
|---|---|
| DownStream 5 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1,3-Adamantanediacetic acid |
| 2,2'-Tricyclo[3.3.1.13,7]decane-1,3-diyldiacetic acid |
| 1,3-Adamantanediaceticacid |
| 2-[3-(Carboxymethyl)-1-adamantyl]acetic acid |
| adamantane-1,3-diacetic acid |
| EINECS 241-751-6 |
| MFCD00191708 |
| 2,2'-Tricyclo[3.3.1.1]decane-1,3-diyldiacetic acid |
| H2ADA |
| Tricyclo[3.3.1.1]decane-1,3-diacetic acid |
| 2,2'-(Adamantane-1,3-diyl)diacetic acid |
| 1,3-Bis(carboxymethyl)adamantane |