2(1H)-Quinolinone,4,8-dimethyl- structure
|
Common Name | 2(1H)-Quinolinone,4,8-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 5349-78-0 | Molecular Weight | 173.21100 | |
| Density | 1.107g/cm3 | Boiling Point | 343.3ºC at 760 mmHg | |
| Molecular Formula | C11H11NO | Melting Point | 219-221ºC | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | 4,8-dimethyl-1H-quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 343.3ºC at 760 mmHg |
| Melting Point | 219-221ºC |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21100 |
| Flash Point | 201.7ºC |
| Exact Mass | 173.08400 |
| PSA | 33.12000 |
| LogP | 2.55720 |
| Index of Refraction | 1.566 |
| InChIKey | NJUAEGGYLOZMGV-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)[nH]c2c(C)cccc12 |
| HS Code | 2933499090 |
|---|
|
~%
2(1H)-Quinolino... CAS#:5349-78-0 |
| Literature: Chemische Berichte, , vol. 17, p. 542 Justus Liebigs Annalen der Chemie, , vol. 245, p. 368 Journal of the Chemical Society, , vol. 103, p. 197 |
|
~%
2(1H)-Quinolino... CAS#:5349-78-0 |
| Literature: Journal of the American Chemical Society, , vol. 68, p. 644,645 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Hydroxy-4,8-dimethyl-chinolin |
| 4,8-Dimethyl-chinolin-2-ol |
| 4,8-dimethyl-2(1H)-quinolinone |
| 4,8-dimethylquinolin-2-ol |
| 4,8-dimethyl-2-hydroxyquinoline |
| 2-hydroxy-4,8-dimethylquinoline |
| dimethylquinolinol |
| 4,8-dimethyl-2-quinolinol |