Aposcopolamine structure
|
Common Name | Aposcopolamine | ||
|---|---|---|---|---|
| CAS Number | 535-26-2 | Molecular Weight | 285.33800 | |
| Density | 1.25g/cm3 | Boiling Point | 415.5ºC at 760mmHg | |
| Molecular Formula | C17H19NO3 | Melting Point | 95-98ºC | |
| MSDS | N/A | Flash Point | 205.1ºC | |
Use of AposcopolamineAposcopolamine is an alkaloid that can be isolated from Datura ferox. Aposcopolamin can closely binds with ACHE, ADRA2A and CHRM2. Aposcopolamine can be used for the research of Alzheimer's disease[1]. |
| Name | apohyoscine |
|---|---|
| Synonym | More Synonyms |
| Description | Aposcopolamine is an alkaloid that can be isolated from Datura ferox. Aposcopolamin can closely binds with ACHE, ADRA2A and CHRM2. Aposcopolamine can be used for the research of Alzheimer's disease[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 415.5ºC at 760mmHg |
| Melting Point | 95-98ºC |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.33800 |
| Flash Point | 205.1ºC |
| Exact Mass | 285.13600 |
| PSA | 42.07000 |
| LogP | 1.79330 |
| Index of Refraction | 1.604 |
| InChIKey | JJNVDCBKBUSUII-SVFSVNPNSA-N |
| SMILES | C=C(C(=O)OC1CC2C3OC3C(C1)N2C)c1ccccc1 |
| Storage condition | -20°C Freezer |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Atropasaeure-(6exo,7exo-epoxy-tropan-3endo-ylester),O-Atropoyl-scopin |
| Atropasaeure-(6exo,7exo-epoxy-tropan-3endo-ylester) |
| aposcopolamine |
| 2-phenyl-acrylic acid 9-methyl-(1rN,2tH,4tH,5cN)-3-oxa-9-aza-tricyclo[3.3.1.02,4]non-7t-yl ester |
| Aposcopolamin |
| atropic acid-(6exo,7exo-epoxy-tropane-3endo-yl ester) |
| OSCINE ATROPATE |
| 6,7-Epoxy-3-atropolyoxytropane |
| a-Methylenebenzeneacetic Acid (1a,2,4,5a,7)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl Ester |